C10H3F6N3 — CID 115564728
6-fluoro-N-(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-amine (PubChem CID 115564728) has the molecular formula C10H3F6N3 and a molecular weight of 279.14 g/mol. Its IUPAC name is 6-fluoro-N-(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-fluoro-N-(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115564728 |
| Molecular Formula | C10H3F6N3 |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 6-fluoro-N-(2,3,4,5,6-pentafluorophenyl)pyrimidin-4-amine |
| SMILES | Fc1cc(Nc2c(F)c(F)c(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C10H3F6N3/c11-3-1-4(18-2-17-3)19-10-8(15)6(13)5(12)7(14)9(10)16/h1-2H,(H,17,18,19) |
| InChIKey | UFBWIXZMOZKZQX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|