C40H34F3N3O6 — CID 11556689
pyridin-3-ylmethyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]butanoyloxy]benzoate (PubChem CID 11556689) has the molecular formula C40H34F3N3O6 and a molecular weight of 709.72 g/mol. Its IUPAC name is pyridin-3-ylmethyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]butanoyloxy]benzoate.
| Compound Name | pyridin-3-ylmethyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]butanoyloxy]benzoate |
|---|---|
| PubChem CID | 11556689 |
| Molecular Formula | C40H34F3N3O6 |
| Molecular Weight | 709.72 g/mol |
| Exact Mass | 709.24 |
| IUPAC Name | pyridin-3-ylmethyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]butanoyloxy]benzoate |
| SMILES | CN(C)C(=O)c1cc(CCCC(=O)Oc2ccc(C(=O)OCc3cccnc3)cc2)ccc1NC(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C40H34F3N3O6/c1-46(2)38(49)34-23-26(7-5-11-36(47)52-31-19-15-29(16-20-31)39(50)51-25-27-8-6-22-44-24-27)12-21-35(34)45-37(48)33-10-4-3-9-32(33)28-13-17-30(18-14-28)40(41,42)43/h3-4,6,8-10,12-24H,5,7,11,25H2,1-2H3,(H,45,48) |
| InChIKey | PHZQIMNSFHTFSN-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.72 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|