C35H33FN6O4 — CID 143216312
[4-(2-methyltetrazol-5-yl)phenyl] 4-[3-(dimethylcarbamoyl)-4-[[2-[4-(fluoromethyl)phenyl]benzoyl]amino]phenyl]butanoate (PubChem CID 143216312) has the molecular formula C35H33FN6O4 and a molecular weight of 620.69 g/mol. Its IUPAC name is [4-(2-methyltetrazol-5-yl)phenyl] 4-[3-(dimethylcarbamoyl)-4-[[2-[4-(fluoromethyl)phenyl]benzoyl]amino]phenyl]butanoate.
| Compound Name | [4-(2-methyltetrazol-5-yl)phenyl] 4-[3-(dimethylcarbamoyl)-4-[[2-[4-(fluoromethyl)phenyl]benzoyl]amino]phenyl]butanoate |
|---|---|
| PubChem CID | 143216312 |
| Molecular Formula | C35H33FN6O4 |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | [4-(2-methyltetrazol-5-yl)phenyl] 4-[3-(dimethylcarbamoyl)-4-[[2-[4-(fluoromethyl)phenyl]benzoyl]amino]phenyl]butanoate |
| SMILES | CN(C)C(=O)c1cc(CCCC(=O)Oc2ccc(-c3nnn(C)n3)cc2)ccc1NC(=O)c1ccccc1-c1ccc(CF)cc1 |
| InChI | InChI=1S/C35H33FN6O4/c1-41(2)35(45)30-21-23(7-6-10-32(43)46-27-18-16-26(17-19-27)33-38-40-42(3)39-33)13-20-31(30)37-34(44)29-9-5-4-8-28(29)25-14-11-24(22-36)12-15-25/h4-5,8-9,11-21H,6-7,10,22H2,1-3H3,(H,37,44) |
| InChIKey | YXMIJVIBEFJKAK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|