C36H33F3N2O6 — CID 11607067
ethyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]butanoyloxy]benzoate (PubChem CID 11607067) has the molecular formula C36H33F3N2O6 and a molecular weight of 646.66 g/mol. Its IUPAC name is ethyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]butanoyloxy]benzoate.
| Compound Name | ethyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]butanoyloxy]benzoate |
|---|---|
| PubChem CID | 11607067 |
| Molecular Formula | C36H33F3N2O6 |
| Molecular Weight | 646.66 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | ethyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]butanoyloxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OC(=O)CCCc2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)c(C(=O)N(C)C)c2)cc1 |
| InChI | InChI=1S/C36H33F3N2O6/c1-4-46-35(45)25-15-19-27(20-16-25)47-32(42)11-7-8-23-12-21-31(30(22-23)34(44)41(2)3)40-33(43)29-10-6-5-9-28(29)24-13-17-26(18-14-24)36(37,38)39/h5-6,9-10,12-22H,4,7-8,11H2,1-3H3,(H,40,43) |
| InChIKey | GIKSZVFMYPFRIL-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|