C38H37F3N2O6 — CID 141251846
methyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-phenyl-6-(trifluoromethyl)benzoyl]amino]phenyl]butanoyloxy]-3-propan-2-ylbenzoate (PubChem CID 141251846) has the molecular formula C38H37F3N2O6 and a molecular weight of 674.72 g/mol. Its IUPAC name is methyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-phenyl-6-(trifluoromethyl)benzoyl]amino]phenyl]butanoyloxy]-3-propan-2-ylbenzoate.
| Compound Name | methyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-phenyl-6-(trifluoromethyl)benzoyl]amino]phenyl]butanoyloxy]-3-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 141251846 |
| Molecular Formula | C38H37F3N2O6 |
| Molecular Weight | 674.72 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | methyl 4-[4-[3-(dimethylcarbamoyl)-4-[[2-phenyl-6-(trifluoromethyl)benzoyl]amino]phenyl]butanoyloxy]-3-propan-2-ylbenzoate |
| SMILES | COC(=O)c1ccc(OC(=O)CCCc2ccc(NC(=O)c3c(-c4ccccc4)cccc3C(F)(F)F)c(C(=O)N(C)C)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C38H37F3N2O6/c1-23(2)28-22-26(37(47)48-5)18-20-32(28)49-33(44)16-9-11-24-17-19-31(29(21-24)36(46)43(3)4)42-35(45)34-27(25-12-7-6-8-13-25)14-10-15-30(34)38(39,40)41/h6-8,10,12-15,17-23H,9,11,16H2,1-5H3,(H,42,45) |
| InChIKey | OHIRGDGWFPRYGD-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.72 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|