C24H21F3N2O2 — CID 141139573
N-[2-[ethyl(methyl)carbamoyl]phenyl]-2-phenyl-6-(trifluoromethyl)benzamide (PubChem CID 141139573) has the molecular formula C24H21F3N2O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)carbamoyl]phenyl]-2-phenyl-6-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[ethyl(methyl)carbamoyl]phenyl]-2-phenyl-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141139573 |
| Molecular Formula | C24H21F3N2O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[2-[ethyl(methyl)carbamoyl]phenyl]-2-phenyl-6-(trifluoromethyl)benzamide |
| SMILES | CCN(C)C(=O)c1ccccc1NC(=O)c1c(-c2ccccc2)cccc1C(F)(F)F |
| InChI | InChI=1S/C24H21F3N2O2/c1-3-29(2)23(31)18-12-7-8-15-20(18)28-22(30)21-17(16-10-5-4-6-11-16)13-9-14-19(21)24(25,26)27/h4-15H,3H2,1-2H3,(H,28,30) |
| InChIKey | HJLVVBMQXBEJDJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |