C30H34N2OSi — CID 177432131
2-phenyl-N-quinolin-8-yl-6-(2-triethylsilylethyl)benzamide (PubChem CID 177432131) has the molecular formula C30H34N2OSi and a molecular weight of 466.70 g/mol. Its IUPAC name is 2-phenyl-N-quinolin-8-yl-6-(2-triethylsilylethyl)benzamide.
| Compound Name | 2-phenyl-N-quinolin-8-yl-6-(2-triethylsilylethyl)benzamide |
|---|---|
| PubChem CID | 177432131 |
| Molecular Formula | C30H34N2OSi |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-phenyl-N-quinolin-8-yl-6-(2-triethylsilylethyl)benzamide |
| SMILES | CC[Si](CC)(CC)CCc1cccc(-c2ccccc2)c1C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C30H34N2OSi/c1-4-34(5-2,6-3)22-20-24-15-10-18-26(23-13-8-7-9-14-23)28(24)30(33)32-27-19-11-16-25-17-12-21-31-29(25)27/h7-19,21H,4-6,20,22H2,1-3H3,(H,32,33) |
| InChIKey | ZMEFVQGNFXYBBQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|