C22H19F3N2O — CID 132547082
2-[(E)-pent-2-enyl]-N-quinolin-8-yl-6-(trifluoromethyl)benzamide (PubChem CID 132547082) has the molecular formula C22H19F3N2O and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-[(E)-pent-2-enyl]-N-quinolin-8-yl-6-(trifluoromethyl)benzamide.
| Compound Name | 2-[(E)-pent-2-enyl]-N-quinolin-8-yl-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 132547082 |
| Molecular Formula | C22H19F3N2O |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[(E)-pent-2-enyl]-N-quinolin-8-yl-6-(trifluoromethyl)benzamide |
| SMILES | CC/C=C/Cc1cccc(C(F)(F)F)c1C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C22H19F3N2O/c1-2-3-4-8-15-9-5-12-17(22(23,24)25)19(15)21(28)27-18-13-6-10-16-11-7-14-26-20(16)18/h3-7,9-14H,2,8H2,1H3,(H,27,28)/b4-3+ |
| InChIKey | ZXCUVENWCSANMS-ONEGZZNKSA-N |
| XLogP | 6.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|