C32H47FN2OSi2 — CID 177414845
3-fluoro-N-quinolin-8-yl-2,6-bis(2-triethylsilylethyl)benzamide (PubChem CID 177414845) has the molecular formula C32H47FN2OSi2 and a molecular weight of 550.91 g/mol. Its IUPAC name is 3-fluoro-N-quinolin-8-yl-2,6-bis(2-triethylsilylethyl)benzamide.
| Compound Name | 3-fluoro-N-quinolin-8-yl-2,6-bis(2-triethylsilylethyl)benzamide |
|---|---|
| PubChem CID | 177414845 |
| Molecular Formula | C32H47FN2OSi2 |
| Molecular Weight | 550.91 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 3-fluoro-N-quinolin-8-yl-2,6-bis(2-triethylsilylethyl)benzamide |
| SMILES | CC[Si](CC)(CC)CCc1ccc(F)c(CC[Si](CC)(CC)CC)c1C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C32H47FN2OSi2/c1-7-37(8-2,9-3)23-20-25-18-19-28(33)27(21-24-38(10-4,11-5)12-6)30(25)32(36)35-29-17-13-15-26-16-14-22-34-31(26)29/h13-19,22H,7-12,20-21,23-24H2,1-6H3,(H,35,36) |
| InChIKey | FXEJUIKFAKOWRL-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.91 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|