C33H33F3N2O2 — CID 69225051
N-(2-hexylphenyl)-2-(trifluoromethyl)benzamide;2-phenylbenzamide (PubChem CID 69225051) has the molecular formula C33H33F3N2O2 and a molecular weight of 546.63 g/mol. Its IUPAC name is N-(2-hexylphenyl)-2-(trifluoromethyl)benzamide;2-phenylbenzamide.
| Compound Name | N-(2-hexylphenyl)-2-(trifluoromethyl)benzamide;2-phenylbenzamide |
|---|---|
| PubChem CID | 69225051 |
| Molecular Formula | C33H33F3N2O2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | N-(2-hexylphenyl)-2-(trifluoromethyl)benzamide;2-phenylbenzamide |
| SMILES | CCCCCCc1ccccc1NC(=O)c1ccccc1C(F)(F)F.NC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H22F3NO.C13H11NO/c1-2-3-4-5-10-15-11-6-9-14-18(15)24-19(25)16-12-7-8-13-17(16)20(21,22)23;14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h6-9,11-14H,2-5,10H2,1H3,(H,24,25);1-9H,(H2,14,15) |
| InChIKey | WFOHDYUZWANJFP-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|