C11H19F3N2S — CID 115570996
N-(2-methylpropyl)-3-(trifluoromethyl)piperidine-1-carbothioamide (PubChem CID 115570996) has the molecular formula C11H19F3N2S and a molecular weight of 268.35 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-(trifluoromethyl)piperidine-1-carbothioamide.
| Compound Name | N-(2-methylpropyl)-3-(trifluoromethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 115570996 |
| Molecular Formula | C11H19F3N2S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(2-methylpropyl)-3-(trifluoromethyl)piperidine-1-carbothioamide |
| SMILES | CC(C)CNC(=S)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2S/c1-8(2)6-15-10(17)16-5-3-4-9(7-16)11(12,13)14/h8-9H,3-7H2,1-2H3,(H,15,17) |
| InChIKey | DKUUURMOUJQXTF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|