C11H23N3OS — CID 115573160
N-tert-butyl-2-(butylcarbamothioylamino)acetamide (PubChem CID 115573160) has the molecular formula C11H23N3OS and a molecular weight of 245.39 g/mol. Its IUPAC name is N-tert-butyl-2-(butylcarbamothioylamino)acetamide.
| Compound Name | N-tert-butyl-2-(butylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 115573160 |
| Molecular Formula | C11H23N3OS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-tert-butyl-2-(butylcarbamothioylamino)acetamide |
| SMILES | CCCCNC(=S)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H23N3OS/c1-5-6-7-12-10(16)13-8-9(15)14-11(2,3)4/h5-8H2,1-4H3,(H,14,15)(H2,12,13,16) |
| InChIKey | ZYMYMFLLBXXVHS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|