C9H7ClN2OS — CID 115575432
3-[(E)-3-chloroprop-2-enyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 115575432) has the molecular formula C9H7ClN2OS and a molecular weight of 226.69 g/mol. Its IUPAC name is 3-[(E)-3-chloroprop-2-enyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[(E)-3-chloroprop-2-enyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 115575432 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 3-[(E)-3-chloroprop-2-enyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2ncn1C/C=C/Cl |
| InChI | InChI=1S/C9H7ClN2OS/c10-3-1-4-12-6-11-7-2-5-14-8(7)9(12)13/h1-3,5-6H,4H2/b3-1+ |
| InChIKey | UPKCOVSQVFMCCZ-HNQUOIGGSA-N |
| XLogP | 2.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |