C14H13N3O3 — CID 115582512
5,6-dimethyl-1-[(5-nitrofuran-2-yl)methyl]benzimidazole (PubChem CID 115582512) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 5,6-dimethyl-1-[(5-nitrofuran-2-yl)methyl]benzimidazole.
| Compound Name | 5,6-dimethyl-1-[(5-nitrofuran-2-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 115582512 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 5,6-dimethyl-1-[(5-nitrofuran-2-yl)methyl]benzimidazole |
| SMILES | Cc1cc2ncn(Cc3ccc([N+](=O)[O-])o3)c2cc1C |
| InChI | InChI=1S/C14H13N3O3/c1-9-5-12-13(6-10(9)2)16(8-15-12)7-11-3-4-14(20-11)17(18)19/h3-6,8H,7H2,1-2H3 |
| InChIKey | JMMCYEJEUUXMOA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|