C14H14N2O3S — CID 11558345
(E)-3-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 11558345) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is (E)-3-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11558345 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (E)-3-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc(/C=C/C(N)=O)c2)cc1 |
| InChI | InChI=1S/C14H14N2O3S/c1-11-2-5-13(6-3-11)20(18,19)16-9-8-12(10-16)4-7-14(15)17/h2-10H,1H3,(H2,15,17)/b7-4+ |
| InChIKey | WJZYYKJJZXDXFX-QPJJXVBHSA-N |
| XLogP | 1.53 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|