C19H24N2O4S — CID 66646108
tert-butyl (E)-3-[1-[4-(dimethylamino)phenyl]sulfonylpyrrol-3-yl]prop-2-enoate (PubChem CID 66646108) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is tert-butyl (E)-3-[1-[4-(dimethylamino)phenyl]sulfonylpyrrol-3-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[1-[4-(dimethylamino)phenyl]sulfonylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66646108 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | tert-butyl (E)-3-[1-[4-(dimethylamino)phenyl]sulfonylpyrrol-3-yl]prop-2-enoate |
| SMILES | CN(C)c1ccc(S(=O)(=O)n2ccc(/C=C/C(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-19(2,3)25-18(22)11-6-15-12-13-21(14-15)26(23,24)17-9-7-16(8-10-17)20(4)5/h6-14H,1-5H3/b11-6+ |
| InChIKey | LPKGRBWZNKUQGP-IZZDOVSWSA-N |
| XLogP | 3.15 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|