C28H27N3O5S — CID 86630028
tert-butyl N-[2-[[(E)-3-(1-naphthalen-2-ylsulfonylpyrrol-3-yl)prop-2-enoyl]amino]phenyl]carbamate (PubChem CID 86630028) has the molecular formula C28H27N3O5S and a molecular weight of 517.61 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-3-(1-naphthalen-2-ylsulfonylpyrrol-3-yl)prop-2-enoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(E)-3-(1-naphthalen-2-ylsulfonylpyrrol-3-yl)prop-2-enoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 86630028 |
| Molecular Formula | C28H27N3O5S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | tert-butyl N-[2-[[(E)-3-(1-naphthalen-2-ylsulfonylpyrrol-3-yl)prop-2-enoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)/C=C/c1ccn(S(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C28H27N3O5S/c1-28(2,3)36-27(33)30-25-11-7-6-10-24(25)29-26(32)15-12-20-16-17-31(19-20)37(34,35)23-14-13-21-8-4-5-9-22(21)18-23/h4-19H,1-3H3,(H,29,32)(H,30,33)/b15-12+ |
| InChIKey | FNOIZJPYKUJZEH-NTCAYCPXSA-N |
| XLogP | 5.88 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|