C23H21N5O3S — CID 68528273
N-(2-aminophenyl)-3-[1-[3-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 68528273) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[1-[3-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[1-[3-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 68528273 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-(2-aminophenyl)-3-[1-[3-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | Cn1cc(-c2cccc(S(=O)(=O)n3ccc(C=CC(=O)Nc4ccccc4N)c3)c2)cn1 |
| InChI | InChI=1S/C23H21N5O3S/c1-27-16-19(14-25-27)18-5-4-6-20(13-18)32(30,31)28-12-11-17(15-28)9-10-23(29)26-22-8-3-2-7-21(22)24/h2-16H,24H2,1H3,(H,26,29) |
| InChIKey | JNNQXNXMJCILKJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|