C26H24N4O5S2 — CID 68526538
N-(2-aminophenyl)-3-[1-[4-[3-(methanesulfonamido)phenyl]phenyl]sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 68526538) has the molecular formula C26H24N4O5S2 and a molecular weight of 536.64 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[1-[4-[3-(methanesulfonamido)phenyl]phenyl]sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[1-[4-[3-(methanesulfonamido)phenyl]phenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 68526538 |
| Molecular Formula | C26H24N4O5S2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | N-(2-aminophenyl)-3-[1-[4-[3-(methanesulfonamido)phenyl]phenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2ccc(S(=O)(=O)n3ccc(C=CC(=O)Nc4ccccc4N)c3)cc2)c1 |
| InChI | InChI=1S/C26H24N4O5S2/c1-36(32,33)29-22-6-4-5-21(17-22)20-10-12-23(13-11-20)37(34,35)30-16-15-19(18-30)9-14-26(31)28-25-8-3-2-7-24(25)27/h2-18,29H,27H2,1H3,(H,28,31) |
| InChIKey | YGNYTPBJGLHVBK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|