C22H18N4O3S2 — CID 11604830
(E)-N-(2-aminophenyl)-3-[1-(5-pyridin-2-ylthiophen-2-yl)sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 11604830) has the molecular formula C22H18N4O3S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[1-(5-pyridin-2-ylthiophen-2-yl)sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[1-(5-pyridin-2-ylthiophen-2-yl)sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11604830 |
| Molecular Formula | C22H18N4O3S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[1-(5-pyridin-2-ylthiophen-2-yl)sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccn(S(=O)(=O)c2ccc(-c3ccccn3)s2)c1 |
| InChI | InChI=1S/C22H18N4O3S2/c23-17-5-1-2-6-18(17)25-21(27)10-8-16-12-14-26(15-16)31(28,29)22-11-9-20(30-22)19-7-3-4-13-24-19/h1-15H,23H2,(H,25,27)/b10-8+ |
| InChIKey | PPEKFPNXLGNKFN-CSKARUKUSA-N |
| XLogP | 4.08 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|