C27H24N4O4S — CID 154636029
(E)-3-[1-(2-acetamido-6-phenylphenyl)sulfonylpyrrol-3-yl]-N-(2-aminophenyl)prop-2-enamide (PubChem CID 154636029) has the molecular formula C27H24N4O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is (E)-3-[1-(2-acetamido-6-phenylphenyl)sulfonylpyrrol-3-yl]-N-(2-aminophenyl)prop-2-enamide.
| Compound Name | (E)-3-[1-(2-acetamido-6-phenylphenyl)sulfonylpyrrol-3-yl]-N-(2-aminophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 154636029 |
| Molecular Formula | C27H24N4O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (E)-3-[1-(2-acetamido-6-phenylphenyl)sulfonylpyrrol-3-yl]-N-(2-aminophenyl)prop-2-enamide |
| SMILES | CC(=O)Nc1cccc(-c2ccccc2)c1S(=O)(=O)n1ccc(/C=C/C(=O)Nc2ccccc2N)c1 |
| InChI | InChI=1S/C27H24N4O4S/c1-19(32)29-25-13-7-10-22(21-8-3-2-4-9-21)27(25)36(34,35)31-17-16-20(18-31)14-15-26(33)30-24-12-6-5-11-23(24)28/h2-18H,28H2,1H3,(H,29,32)(H,30,33)/b15-14+ |
| InChIKey | HJVWYWUWFXZKEF-CCEZHUSRSA-N |
| XLogP | 4.58 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|