C18H19N3O7S3 — CID 87088778
ethanesulfonic acid;(E)-N-hydroxy-3-[1-(5-pyridin-2-ylthiophen-2-yl)sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 87088778) has the molecular formula C18H19N3O7S3 and a molecular weight of 485.57 g/mol. Its IUPAC name is ethanesulfonic acid;(E)-N-hydroxy-3-[1-(5-pyridin-2-ylthiophen-2-yl)sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | ethanesulfonic acid;(E)-N-hydroxy-3-[1-(5-pyridin-2-ylthiophen-2-yl)sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 87088778 |
| Molecular Formula | C18H19N3O7S3 |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | ethanesulfonic acid;(E)-N-hydroxy-3-[1-(5-pyridin-2-ylthiophen-2-yl)sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | CCS(=O)(=O)O.O=C(/C=C/c1ccn(S(=O)(=O)c2ccc(-c3ccccn3)s2)c1)NO |
| InChI | InChI=1S/C16H13N3O4S2.C2H6O3S/c20-15(18-21)6-4-12-8-10-19(11-12)25(22,23)16-7-5-14(24-16)13-3-1-2-9-17-13;1-2-6(3,4)5/h1-11,21H,(H,18,20);2H2,1H3,(H,3,4,5)/b6-4+; |
| InChIKey | VMGQITPUDUBABR-CVDVRWGVSA-N |
| XLogP | 2.26 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|