C32H32N4O6S — CID 140547850
[2-[[(E)-3-[1-[3-[3-(2-morpholin-4-ylethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]prop-2-enoyl]amino]phenyl]carbamic acid (PubChem CID 140547850) has the molecular formula C32H32N4O6S and a molecular weight of 600.70 g/mol. Its IUPAC name is [2-[[(E)-3-[1-[3-[3-(2-morpholin-4-ylethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]prop-2-enoyl]amino]phenyl]carbamic acid.
| Compound Name | [2-[[(E)-3-[1-[3-[3-(2-morpholin-4-ylethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]prop-2-enoyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 140547850 |
| Molecular Formula | C32H32N4O6S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | [2-[[(E)-3-[1-[3-[3-(2-morpholin-4-ylethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]prop-2-enoyl]amino]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccccc1NC(=O)/C=C/c1ccn(S(=O)(=O)c2cccc(-c3cccc(CCN4CCOCC4)c3)c2)c1 |
| InChI | InChI=1S/C32H32N4O6S/c37-31(33-29-9-1-2-10-30(29)34-32(38)39)12-11-25-14-16-36(23-25)43(40,41)28-8-4-7-27(22-28)26-6-3-5-24(21-26)13-15-35-17-19-42-20-18-35/h1-12,14,16,21-23,34H,13,15,17-20H2,(H,33,37)(H,38,39)/b12-11+ |
| InChIKey | DCOCWUUWOWAVKI-VAWYXSNFSA-N |
| XLogP | 5.01 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|