C29H33N3O6S — CID 173090472
3-[1-[3-[4-(morpholin-4-ylmethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 173090472) has the molecular formula C29H33N3O6S and a molecular weight of 551.67 g/mol. Its IUPAC name is 3-[1-[3-[4-(morpholin-4-ylmethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | 3-[1-[3-[4-(morpholin-4-ylmethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 173090472 |
| Molecular Formula | C29H33N3O6S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 3-[1-[3-[4-(morpholin-4-ylmethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(C=Cc1ccn(S(=O)(=O)c2cccc(-c3ccc(CN4CCOCC4)cc3)c2)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C29H33N3O6S/c33-28(30-38-29-6-1-2-17-37-29)12-9-24-13-14-32(22-24)39(34,35)27-5-3-4-26(20-27)25-10-7-23(8-11-25)21-31-15-18-36-19-16-31/h3-5,7-14,20,22,29H,1-2,6,15-19,21H2,(H,30,33) |
| InChIKey | QOZHIAXQBUTFFD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|