C29H33N3O7S — CID 87485402
(E)-N-hydroxy-3-[1-[4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 87485402) has the molecular formula C29H33N3O7S and a molecular weight of 567.66 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 87485402 |
| Molecular Formula | C29H33N3O7S |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]sulfonylpyrrol-3-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccn(S(=O)(=O)c2ccc(-c3cccc(CN4CCOCC4)c3)cc2)c1)N(O)OC1CCCCO1 |
| InChI | InChI=1S/C29H33N3O7S/c33-28(32(34)39-29-6-1-2-17-38-29)12-7-23-13-14-31(22-23)40(35,36)27-10-8-25(9-11-27)26-5-3-4-24(20-26)21-30-15-18-37-19-16-30/h3-5,7-14,20,22,29,34H,1-2,6,15-19,21H2/b12-7+ |
| InChIKey | GDQCPYAKDMCVQL-KPKJPENVSA-N |
| XLogP | 3.91 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|