C26H29N3O6S — CID 87524728
(E)-N-hydroxy-3-[1-[2-(3-morpholin-4-ylpropoxy)-5-phenylphenyl]sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 87524728) has the molecular formula C26H29N3O6S and a molecular weight of 511.60 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[2-(3-morpholin-4-ylpropoxy)-5-phenylphenyl]sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[2-(3-morpholin-4-ylpropoxy)-5-phenylphenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 87524728 |
| Molecular Formula | C26H29N3O6S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[2-(3-morpholin-4-ylpropoxy)-5-phenylphenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccn(S(=O)(=O)c2cc(-c3ccccc3)ccc2OCCCN2CCOCC2)c1)NO |
| InChI | InChI=1S/C26H29N3O6S/c30-26(27-31)10-7-21-11-13-29(20-21)36(32,33)25-19-23(22-5-2-1-3-6-22)8-9-24(25)35-16-4-12-28-14-17-34-18-15-28/h1-3,5-11,13,19-20,31H,4,12,14-18H2,(H,27,30)/b10-7+ |
| InChIKey | FBLFYLYZZUSUGE-JXMROGBWSA-N |
| XLogP | 3.01 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|