C27H29N3O5S — CID 174540410
(E)-N-hydroxy-3-[1-[1-[2-(morpholin-4-ylmethyl)-4-phenylphenyl]prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enamide (PubChem CID 174540410) has the molecular formula C27H29N3O5S and a molecular weight of 507.61 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[1-[2-(morpholin-4-ylmethyl)-4-phenylphenyl]prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[1-[2-(morpholin-4-ylmethyl)-4-phenylphenyl]prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 174540410 |
| Molecular Formula | C27H29N3O5S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[1-[2-(morpholin-4-ylmethyl)-4-phenylphenyl]prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enamide |
| SMILES | C=CC(c1ccc(-c2ccccc2)cc1CN1CCOCC1)S(=O)(=O)n1ccc(/C=C/C(=O)NO)c1 |
| InChI | InChI=1S/C27H29N3O5S/c1-2-26(36(33,34)30-13-12-21(19-30)8-11-27(31)28-32)25-10-9-23(22-6-4-3-5-7-22)18-24(25)20-29-14-16-35-17-15-29/h2-13,18-19,26,32H,1,14-17,20H2,(H,28,31)/b11-8+ |
| InChIKey | DMOVKOKCRFCDQC-DHZHZOJOSA-N |
| XLogP | 3.61 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|