C29H33N3O5S — CID 174675175
(E)-N-hydroxy-3-[1-[1-[4-phenyl-2-(3-pyrrolidin-1-ylpropoxy)phenyl]prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enamide (PubChem CID 174675175) has the molecular formula C29H33N3O5S and a molecular weight of 535.67 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[1-[4-phenyl-2-(3-pyrrolidin-1-ylpropoxy)phenyl]prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[1-[4-phenyl-2-(3-pyrrolidin-1-ylpropoxy)phenyl]prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 174675175 |
| Molecular Formula | C29H33N3O5S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[1-[4-phenyl-2-(3-pyrrolidin-1-ylpropoxy)phenyl]prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enamide |
| SMILES | C=CC(c1ccc(-c2ccccc2)cc1OCCCN1CCCC1)S(=O)(=O)n1ccc(/C=C/C(=O)NO)c1 |
| InChI | InChI=1S/C29H33N3O5S/c1-2-28(38(35,36)32-19-15-23(22-32)11-14-29(33)30-34)26-13-12-25(24-9-4-3-5-10-24)21-27(26)37-20-8-18-31-16-6-7-17-31/h2-5,9-15,19,21-22,28,34H,1,6-8,16-18,20H2,(H,30,33)/b14-11+ |
| InChIKey | OSMHVZLJMDWZPX-SDNWHVSQSA-N |
| XLogP | 4.64 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|