C22H26N6O4S — CID 90867690
N-hydroxy-3-[1-[4-[1-(2-piperidin-1-ylethyl)triazol-4-yl]phenyl]sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 90867690) has the molecular formula C22H26N6O4S and a molecular weight of 470.56 g/mol. Its IUPAC name is N-hydroxy-3-[1-[4-[1-(2-piperidin-1-ylethyl)triazol-4-yl]phenyl]sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[1-[4-[1-(2-piperidin-1-ylethyl)triazol-4-yl]phenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90867690 |
| Molecular Formula | C22H26N6O4S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-hydroxy-3-[1-[4-[1-(2-piperidin-1-ylethyl)triazol-4-yl]phenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccn(S(=O)(=O)c2ccc(-c3cn(CCN4CCCCC4)nn3)cc2)c1)NO |
| InChI | InChI=1S/C22H26N6O4S/c29-22(24-30)9-4-18-10-13-28(16-18)33(31,32)20-7-5-19(6-8-20)21-17-27(25-23-21)15-14-26-11-2-1-3-12-26/h4-10,13,16-17,30H,1-3,11-12,14-15H2,(H,24,29) |
| InChIKey | ONANMLBKKJAIPO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|