C24H27N3O5S — CID 87525180
(E)-N-hydroxy-3-[1-[1-(morpholin-4-ylmethyl)-5-phenylcyclohexa-2,4-dien-1-yl]sulfonylpyrrol-3-yl]prop-2-enamide (PubChem CID 87525180) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[1-(morpholin-4-ylmethyl)-5-phenylcyclohexa-2,4-dien-1-yl]sulfonylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[1-(morpholin-4-ylmethyl)-5-phenylcyclohexa-2,4-dien-1-yl]sulfonylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 87525180 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[1-(morpholin-4-ylmethyl)-5-phenylcyclohexa-2,4-dien-1-yl]sulfonylpyrrol-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccn(S(=O)(=O)C2(CN3CCOCC3)C=CC=C(c3ccccc3)C2)c1)NO |
| InChI | InChI=1S/C24H27N3O5S/c28-23(25-29)9-8-20-10-12-27(18-20)33(30,31)24(19-26-13-15-32-16-14-26)11-4-7-22(17-24)21-5-2-1-3-6-21/h1-12,18,29H,13-17,19H2,(H,25,28)/b9-8+ |
| InChIKey | VOWZTFMJKNZPPV-CMDGGOBGSA-N |
| XLogP | 2.30 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|