C30H35N3O7S — CID 91556352
tert-butyl N-[[4-[3-[3-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrrol-1-yl]sulfonylphenyl]phenyl]methyl]carbamate (PubChem CID 91556352) has the molecular formula C30H35N3O7S and a molecular weight of 581.69 g/mol. Its IUPAC name is tert-butyl N-[[4-[3-[3-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrrol-1-yl]sulfonylphenyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[3-[3-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrrol-1-yl]sulfonylphenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 91556352 |
| Molecular Formula | C30H35N3O7S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | tert-butyl N-[[4-[3-[3-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrrol-1-yl]sulfonylphenyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(-c2cccc(S(=O)(=O)n3ccc(C=CC(=O)NOC4CCCCO4)c3)c2)cc1 |
| InChI | InChI=1S/C30H35N3O7S/c1-30(2,3)39-29(35)31-20-22-10-13-24(14-11-22)25-7-6-8-26(19-25)41(36,37)33-17-16-23(21-33)12-15-27(34)32-40-28-9-4-5-18-38-28/h6-8,10-17,19,21,28H,4-5,9,18,20H2,1-3H3,(H,31,35)(H,32,34) |
| InChIKey | XTXGJZYAOSBDGH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|