C34H30N6O5S — CID 76720225
tert-butyl N-[2-[3-[1-[4-(3-ethynylanilino)quinazolin-6-yl]sulfonylpyrrol-3-yl]prop-2-enoylamino]phenyl]carbamate (PubChem CID 76720225) has the molecular formula C34H30N6O5S and a molecular weight of 634.72 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[1-[4-(3-ethynylanilino)quinazolin-6-yl]sulfonylpyrrol-3-yl]prop-2-enoylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[1-[4-(3-ethynylanilino)quinazolin-6-yl]sulfonylpyrrol-3-yl]prop-2-enoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 76720225 |
| Molecular Formula | C34H30N6O5S |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | tert-butyl N-[2-[3-[1-[4-(3-ethynylanilino)quinazolin-6-yl]sulfonylpyrrol-3-yl]prop-2-enoylamino]phenyl]carbamate |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(S(=O)(=O)n4ccc(C=CC(=O)Nc5ccccc5NC(=O)OC(C)(C)C)c4)cc23)c1 |
| InChI | InChI=1S/C34H30N6O5S/c1-5-23-9-8-10-25(19-23)37-32-27-20-26(14-15-28(27)35-22-36-32)46(43,44)40-18-17-24(21-40)13-16-31(41)38-29-11-6-7-12-30(29)39-33(42)45-34(2,3)4/h1,6-22H,2-4H3,(H,38,41)(H,39,42)(H,35,36,37) |
| InChIKey | PWRVUUANRQNPRJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|