C20H28NO7PS — CID 102188690
3-[(Z)-2-diethoxyphosphoryl-2-(2-methoxyethoxy)ethenyl]-1-(4-methylphenyl)sulfonylpyrrole (PubChem CID 102188690) has the molecular formula C20H28NO7PS and a molecular weight of 457.49 g/mol. Its IUPAC name is 3-[(Z)-2-diethoxyphosphoryl-2-(2-methoxyethoxy)ethenyl]-1-(4-methylphenyl)sulfonylpyrrole.
| Compound Name | 3-[(Z)-2-diethoxyphosphoryl-2-(2-methoxyethoxy)ethenyl]-1-(4-methylphenyl)sulfonylpyrrole |
|---|---|
| PubChem CID | 102188690 |
| Molecular Formula | C20H28NO7PS |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3-[(Z)-2-diethoxyphosphoryl-2-(2-methoxyethoxy)ethenyl]-1-(4-methylphenyl)sulfonylpyrrole |
| SMILES | CCOP(=O)(OCC)/C(=C\c1ccn(S(=O)(=O)c2ccc(C)cc2)c1)OCCOC |
| InChI | InChI=1S/C20H28NO7PS/c1-5-27-29(22,28-6-2)20(26-14-13-25-4)15-18-11-12-21(16-18)30(23,24)19-9-7-17(3)8-10-19/h7-12,15-16H,5-6,13-14H2,1-4H3/b20-15- |
| InChIKey | LYQJDZDQTCIJII-HKWRFOASSA-N |
| XLogP | 4.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|