C12H20F3N3O — CID 115583960
4-cyclopentyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide (PubChem CID 115583960) has the molecular formula C12H20F3N3O and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-cyclopentyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide.
| Compound Name | 4-cyclopentyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 115583960 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-cyclopentyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
| SMILES | O=C(NCC(F)(F)F)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C12H20F3N3O/c13-12(14,15)9-16-11(19)18-7-5-17(6-8-18)10-3-1-2-4-10/h10H,1-9H2,(H,16,19) |
| InChIKey | AUYBZNWOTQPTOP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |