C12H15FN2O3S — CID 115590000
4-fluoro-N-[(2-methylcyclopropyl)methyl]-3-sulfamoylbenzamide (PubChem CID 115590000) has the molecular formula C12H15FN2O3S and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-fluoro-N-[(2-methylcyclopropyl)methyl]-3-sulfamoylbenzamide.
| Compound Name | 4-fluoro-N-[(2-methylcyclopropyl)methyl]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115590000 |
| Molecular Formula | C12H15FN2O3S |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-fluoro-N-[(2-methylcyclopropyl)methyl]-3-sulfamoylbenzamide |
| SMILES | CC1CC1CNC(=O)c1ccc(F)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H15FN2O3S/c1-7-4-9(7)6-15-12(16)8-2-3-10(13)11(5-8)19(14,17)18/h2-3,5,7,9H,4,6H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | QWKKFQHMGZEDHI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |