C9H17F3N2S — CID 115591638
1-methyl-3-(2-methylpropyl)-1-(3,3,3-trifluoropropyl)thiourea (PubChem CID 115591638) has the molecular formula C9H17F3N2S and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-methyl-3-(2-methylpropyl)-1-(3,3,3-trifluoropropyl)thiourea.
| Compound Name | 1-methyl-3-(2-methylpropyl)-1-(3,3,3-trifluoropropyl)thiourea |
|---|---|
| PubChem CID | 115591638 |
| Molecular Formula | C9H17F3N2S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-methyl-3-(2-methylpropyl)-1-(3,3,3-trifluoropropyl)thiourea |
| SMILES | CC(C)CNC(=S)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2S/c1-7(2)6-13-8(15)14(3)5-4-9(10,11)12/h7H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | GHEZNDKAQKCJGB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|