C13H28N2S — CID 19653244
1,1,3-tris(2-methylpropyl)thiourea (PubChem CID 19653244) has the molecular formula C13H28N2S and a molecular weight of 244.45 g/mol. Its IUPAC name is 1,1,3-tris(2-methylpropyl)thiourea.
| Compound Name | 1,1,3-tris(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 19653244 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 1,1,3-tris(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H28N2S/c1-10(2)7-14-13(16)15(8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3,(H,14,16) |
| InChIKey | VNRJGCHFGKOPJE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|