About N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine
N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine (PubChem CID 115594943) has the molecular formula C9H12BrN3
and a molecular weight of 242.12 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine |
| PubChem CID | 115594943 |
| Molecular Formula | C9H12BrN3 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine |
| SMILES | C=C(Br)CNc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C9H12BrN3/c1-6(10)5-11-9-12-7(2)4-8(3)13-9/h4H,1,5H2,2-3H3,(H,11,12,13) |
| InChIKey | XOSDTKAXCVPWSS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine?
The IUPAC name of N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine (CID 115594943) is N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine.
What is the SMILES notation for N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine?
The canonical SMILES for N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine is C=C(Br)CNc1nc(C)cc(C)n1.
What is the InChIKey of N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine?
The InChIKey is XOSDTKAXCVPWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN3/c1-6(10)5-11-9-12-7(2)4-8(3)13-9/h4H,1,5H2,2-3H3,(H,11,12,13).
What are the key properties of N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine?
N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine has a molecular weight of 242.12 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoprop-2-enyl)-4,6-dimethylpyrimidin-2-amine is sourced from PubChem (CID 115594943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).