C10H16N4O — CID 43420785
2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide (PubChem CID 43420785) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide.
| Compound Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 43420785 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C10H16N4O/c1-4-11-9(15)6-12-10-13-7(2)5-8(3)14-10/h5H,4,6H2,1-3H3,(H,11,15)(H,12,13,14) |
| InChIKey | JMIUKPPUJOFKIH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |