C7H12N6O — CID 126979187
2-[(4-amino-1,3,5-triazin-2-yl)amino]-N-ethylacetamide (PubChem CID 126979187) has the molecular formula C7H12N6O and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-[(4-amino-1,3,5-triazin-2-yl)amino]-N-ethylacetamide.
| Compound Name | 2-[(4-amino-1,3,5-triazin-2-yl)amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 126979187 |
| Molecular Formula | C7H12N6O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-[(4-amino-1,3,5-triazin-2-yl)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNc1ncnc(N)n1 |
| InChI | InChI=1S/C7H12N6O/c1-2-9-5(14)3-10-7-12-4-11-6(8)13-7/h4H,2-3H2,1H3,(H,9,14)(H3,8,10,11,12,13) |
| InChIKey | XYCQDZWXSVSNEI-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |