About 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole
2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole (PubChem CID 11559546) has the molecular formula C22H20N2O3
and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole.
Molecular Properties
| Compound Name | 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole |
| PubChem CID | 11559546 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole |
| SMILES | COc1cc(-n2ccnc2-c2ccc3ccccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H20N2O3/c1-25-19-13-18(14-20(26-2)21(19)27-3)24-11-10-23-22(24)17-9-8-15-6-4-5-7-16(15)12-17/h4-14H,1-3H3 |
| InChIKey | NJSASTDWMGNLHN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole?
The IUPAC name of 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole (CID 11559546) is 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole.
What is the SMILES notation for 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole?
The canonical SMILES for 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole is COc1cc(-n2ccnc2-c2ccc3ccccc3c2)cc(OC)c1OC.
What is the InChIKey of 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole?
The InChIKey is NJSASTDWMGNLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O3/c1-25-19-13-18(14-20(26-2)21(19)27-3)24-11-10-23-22(24)17-9-8-15-6-4-5-7-16(15)12-17/h4-14H,1-3H3.
What are the key properties of 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole?
2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole has a molecular weight of 360.41 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-yl-1-(3,4,5-trimethoxyphenyl)imidazole is sourced from PubChem (CID 11559546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).