C19H20N2O5 — CID 10959219
2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]phenol (PubChem CID 10959219) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]phenol.
| Compound Name | 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]phenol |
|---|---|
| PubChem CID | 10959219 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]phenol |
| SMILES | COc1ccc(-c2cncn2-c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C19H20N2O5/c1-23-16-6-5-12(7-15(16)22)14-10-20-11-21(14)13-8-17(24-2)19(26-4)18(9-13)25-3/h5-11,22H,1-4H3 |
| InChIKey | DJFPFYVLJXYUSM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |