C20H23N3O4 — CID 11728350
2-methoxy-5-[1-methyl-5-(3,4,5-trimethoxyphenyl)imidazol-4-yl]aniline (PubChem CID 11728350) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-methoxy-5-[1-methyl-5-(3,4,5-trimethoxyphenyl)imidazol-4-yl]aniline.
| Compound Name | 2-methoxy-5-[1-methyl-5-(3,4,5-trimethoxyphenyl)imidazol-4-yl]aniline |
|---|---|
| PubChem CID | 11728350 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-methoxy-5-[1-methyl-5-(3,4,5-trimethoxyphenyl)imidazol-4-yl]aniline |
| SMILES | COc1ccc(-c2ncn(C)c2-c2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C20H23N3O4/c1-23-11-22-18(12-6-7-15(24-2)14(21)8-12)19(23)13-9-16(25-3)20(27-5)17(10-13)26-4/h6-11H,21H2,1-5H3 |
| InChIKey | GHSWWQSJHMWVIK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|