C19H21N3O4 — CID 10948240
2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]aniline (PubChem CID 10948240) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]aniline.
| Compound Name | 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]aniline |
|---|---|
| PubChem CID | 10948240 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]aniline |
| SMILES | COc1ccc(-c2[nH]cnc2-c2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C19H21N3O4/c1-23-14-6-5-11(7-13(14)20)17-18(22-10-21-17)12-8-15(24-2)19(26-4)16(9-12)25-3/h5-10H,20H2,1-4H3,(H,21,22) |
| InChIKey | BXDOMEUYMUKTSS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|