C19H20N2O5 — CID 11013714
2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]phenol (PubChem CID 11013714) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]phenol.
| Compound Name | 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]phenol |
|---|---|
| PubChem CID | 11013714 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]phenol |
| SMILES | COc1ccc(-c2[nH]cnc2-c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C19H20N2O5/c1-23-14-6-5-11(7-13(14)22)17-18(21-10-20-17)12-8-15(24-2)19(26-4)16(9-12)25-3/h5-10,22H,1-4H3,(H,20,21) |
| InChIKey | UOKRDWRYEAWVIV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |