C10H20N2OS2 — CID 115599640
1-(1-methoxypropan-2-yl)-3-(thian-4-yl)thiourea (PubChem CID 115599640) has the molecular formula C10H20N2OS2 and a molecular weight of 248.42 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-3-(thian-4-yl)thiourea.
| Compound Name | 1-(1-methoxypropan-2-yl)-3-(thian-4-yl)thiourea |
|---|---|
| PubChem CID | 115599640 |
| Molecular Formula | C10H20N2OS2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-3-(thian-4-yl)thiourea |
| SMILES | COCC(C)NC(=S)NC1CCSCC1 |
| InChI | InChI=1S/C10H20N2OS2/c1-8(7-13-2)11-10(14)12-9-3-5-15-6-4-9/h8-9H,3-7H2,1-2H3,(H2,11,12,14) |
| InChIKey | LKCWHCSEDBMDBO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|