C14H30N3OS+ — CID 9112302
1-[(2S)-1-methoxypropan-2-yl]-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea (PubChem CID 9112302) has the molecular formula C14H30N3OS+ and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-[(2S)-1-methoxypropan-2-yl]-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea.
| Compound Name | 1-[(2S)-1-methoxypropan-2-yl]-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea |
|---|---|
| PubChem CID | 9112302 |
| Molecular Formula | C14H30N3OS+ |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-[(2S)-1-methoxypropan-2-yl]-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea |
| SMILES | COC[C@H](C)NC(=S)NC1CC(C)(C)[NH2+]C(C)(C)C1 |
| InChI | InChI=1S/C14H29N3OS/c1-10(9-18-6)15-12(19)16-11-7-13(2,3)17-14(4,5)8-11/h10-11,17H,7-9H2,1-6H3,(H2,15,16,19)/p+1/t10-/m0/s1 |
| InChIKey | YOEXRPLVYGZEQQ-JTQLQIEISA-O |
| XLogP | 0.77 |
| TPSA | 49.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|