C13H28N3S+ — CID 7942560
1-propyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea (PubChem CID 7942560) has the molecular formula C13H28N3S+ and a molecular weight of 258.45 g/mol. Its IUPAC name is 1-propyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea.
| Compound Name | 1-propyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea |
|---|---|
| PubChem CID | 7942560 |
| Molecular Formula | C13H28N3S+ |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 1-propyl-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea |
| SMILES | CCCNC(=S)NC1CC(C)(C)[NH2+]C(C)(C)C1 |
| InChI | InChI=1S/C13H27N3S/c1-6-7-14-11(17)15-10-8-12(2,3)16-13(4,5)9-10/h10,16H,6-9H2,1-5H3,(H2,14,15,17)/p+1 |
| InChIKey | BMFIMBDHBARWQR-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 40.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|