C17H28N3S+ — CID 4196077
1-(4-methylphenyl)-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea (PubChem CID 4196077) has the molecular formula C17H28N3S+ and a molecular weight of 306.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea.
| Compound Name | 1-(4-methylphenyl)-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea |
|---|---|
| PubChem CID | 4196077 |
| Molecular Formula | C17H28N3S+ |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1-(4-methylphenyl)-3-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC2CC(C)(C)[NH2+]C(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H27N3S/c1-12-6-8-13(9-7-12)18-15(21)19-14-10-16(2,3)20-17(4,5)11-14/h6-9,14,20H,10-11H2,1-5H3,(H2,18,19,21)/p+1 |
| InChIKey | BYVLBFYKCXKNGS-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 40.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|