C24H30N4S2 — CID 2483623
1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 2483623) has the molecular formula C24H30N4S2 and a molecular weight of 438.67 g/mol. Its IUPAC name is 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 2483623 |
| Molecular Formula | C24H30N4S2 |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=S)NC4CC(C)(C)NC(C)(C)C4)cc3)sc2c1 |
| InChI | InChI=1S/C24H30N4S2/c1-15-6-11-19-20(12-15)30-21(27-19)16-7-9-17(10-8-16)25-22(29)26-18-13-23(2,3)28-24(4,5)14-18/h6-12,18,28H,13-14H2,1-5H3,(H2,25,26,29) |
| InChIKey | ZMECXCUFCNSLRG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|